Final answer:
The alkene that would react with bromine to form the given product is hex-3-ene, as it has a double bond between the third and fourth carbons that allows for the halogenation reaction to form a vicinal dibromide.
Step-by-step explanation:
The student is asking for the name of the alkene that would react with bromine (Br2) to form a specific alkyl halide. The molecule provided by the student is Br-CH2-CH2-CH2-CH(Br)-CH(CH3)2, which has a bromine atom on both the first and fourth carbons of a six-carbon chain.
This product indicates that the original alkene must have had a double bond between the third and fourth carbons, making it hex-3-ene. The addition of bromine to an alkene in such a manner is known as a halogenation reaction and typically results in a vicinal dibromide, where the bromine atoms add across the double bond of the alkene.