Register
The weak ionization constant (Ka)for HCNO is equal to:АB[HCNO][H20][H+][CNO-]ICMO-u +uure
88.7k views
3 votes
The weak ionization constant (Ka)for HCNO is equal to:АB[HCNO][H20][H+][CNO-]ICMO-u +uure

The weak ionization constant (Ka)for HCNO is equal to:АB[HCNO][H20][H+][CNO-]ICMO-example-1
User Dima Maligin
by
6.6k points

1 Answer

0 votes

answer

the correct option is B

User MooseBoys
by
6.7k points
Ask a Question
Welcome to QAmmunity.org, where you can ask questions and receive answers from other members of our community.

7.5m questions

10.1m answers

Other Questions

How do you balance __H2SO4 + __B(OH)3 --> __B2(SO4)3 + __H2O
Can someone complete the chemical reactions, or write which one do not occur, and provide tehir types? *c2h4+h2o *c3h8 + hcl *c2h2+br2 *c4h10+br2 *c3h6+br2
As an object’s temperature increases, the ____________________ at which it radiates energy increases.
What is the evidence of a chemical reaction when the fireworks go off
Which of the following statements does not describe a physical property of a piece of chalk A. Chalk is solid B.chalk can be broken into pieces C. Chalk is white D. Chalk will bubble in vinegar
Link Copied!