Question

Use Markovnikov's rule to predict the product of the addition of water (hydration) to each compound. Draw the skeletal structure of the reactant and product (and name the product). 2,4-dimethyl-3-octene

Answer 1

explain more about this question please.

it is hard to understand

sorry

Answer 2

Applying Markovnikov's rule, the product of the addition of water to 2,4-dimethyl-3-octene is 2,4-dimethyl-3-octanol.

Step-by-step explanation:

To predict the product of the addition of water (hydration) to 2,4-dimethyl-3-octene, we need to apply Markovnikov's rule. According to this rule, the hydrogen atom in the water molecule will add to the carbon atom of the double bond that has fewer hydrogen atoms bonded to it. This means that the hydrogen atom will add to the 2-methyl group (the carbon atom attached to the methyl group) of 2,4-dimethyl-3-octene.

After the addition of water, the product will be 2,4-dimethyl-3-octanol. I will now draw the skeletal structures of the reactant and product:

Skeletal structure of the reactant: CH3-CH(CH3)-C(CH3)=CH-CH2-CH2-CH2-CH3

Product: CH3-CH(CH3)-C(CH3)(OH)-CH(CH2)-CH2-CH2-CH3

Name of the product: 2,4-dimethyl-3-octanol