Answer:
True
Step-by-step explanation:
Halogens belongs to the seventh group on the periodic table. This group contains the most reactive set of elements that we have. They require just an electron to achieve a noble and stable electronic configuration.
When halogens mostly in form of ChloroFluoroCarbons(CFCs) reaches the atmoshpere, ultraviolet rays release chlorine atoms which easily breaks away an oxygen atom from ozone. Ozone thereby turns into an oxygen gas with two oxygen atoms instead of three. This reaction depletes the ozone layer.